C23H19N3O3S — CID 108770580
2,6-dimethoxy-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]benzamide (PubChem CID 108770580) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 108770580 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2,6-dimethoxy-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1cccc(-c2csc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C23H19N3O3S/c1-28-19-7-4-8-20(29-2)21(19)22(27)25-17-6-3-5-16(13-17)18-14-30-23(26-18)15-9-11-24-12-10-15/h3-14H,1-2H3,(H,25,27) |
| InChIKey | UIJZQGIZVVCIPS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |