C25H22N2O3S — CID 108762322
2,6-dimethoxy-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide (PubChem CID 108762322) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 108762322 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2,6-dimethoxy-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCc1ccc(-c2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C25H22N2O3S/c1-29-21-9-6-10-22(30-2)23(21)24(28)26-15-17-11-13-19(14-12-17)25-27-20(16-31-25)18-7-4-3-5-8-18/h3-14,16H,15H2,1-2H3,(H,26,28) |
| InChIKey | ANLPZIQDLUNGCE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |