C23H16F2N2OS — CID 108739729
2,4-difluoro-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide (PubChem CID 108739729) has the molecular formula C23H16F2N2OS and a molecular weight of 406.46 g/mol. Its IUPAC name is 2,4-difluoro-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide.
| Compound Name | 2,4-difluoro-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 108739729 |
| Molecular Formula | C23H16F2N2OS |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 2,4-difluoro-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(-c2nc(-c3ccccc3)cs2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H16F2N2OS/c24-18-10-11-19(20(25)12-18)22(28)26-13-15-6-8-17(9-7-15)23-27-21(14-29-23)16-4-2-1-3-5-16/h1-12,14H,13H2,(H,26,28) |
| InChIKey | ZOVJJYZXTJAECS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |