C24H17F3N2OS — CID 108738396
2,3,4-trifluoro-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]benzamide (PubChem CID 108738396) has the molecular formula C24H17F3N2OS and a molecular weight of 438.47 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 108738396 |
| Molecular Formula | C24H17F3N2OS |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2,3,4-trifluoro-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]benzamide |
| SMILES | Cc1ccc(-c2csc(-c3ccc(CNC(=O)c4ccc(F)c(F)c4F)cc3)n2)cc1 |
| InChI | InChI=1S/C24H17F3N2OS/c1-14-2-6-16(7-3-14)20-13-31-24(29-20)17-8-4-15(5-9-17)12-28-23(30)18-10-11-19(25)22(27)21(18)26/h2-11,13H,12H2,1H3,(H,28,30) |
| InChIKey | ZELCMIXSRFVWJJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|