C22H12ClF3N2OS — CID 108748174
N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2,3,4-trifluorobenzamide (PubChem CID 108748174) has the molecular formula C22H12ClF3N2OS and a molecular weight of 444.87 g/mol. Its IUPAC name is N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108748174 |
| Molecular Formula | C22H12ClF3N2OS |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2,3,4-trifluorobenzamide |
| SMILES | O=C(Nc1ccc(-c2csc(-c3ccc(Cl)cc3)n2)cc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H12ClF3N2OS/c23-14-5-1-13(2-6-14)22-28-18(11-30-22)12-3-7-15(8-4-12)27-21(29)16-9-10-17(24)20(26)19(16)25/h1-11H,(H,27,29) |
| InChIKey | RKVTVGGEDYNBAS-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|