C30H23ClN2OS — CID 108748251
N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3,3-diphenylpropanamide (PubChem CID 108748251) has the molecular formula C30H23ClN2OS and a molecular weight of 495.05 g/mol. Its IUPAC name is N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3,3-diphenylpropanamide.
| Compound Name | N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 108748251 |
| Molecular Formula | C30H23ClN2OS |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1ccc(-c2csc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C30H23ClN2OS/c31-25-15-11-24(12-16-25)30-33-28(20-35-30)23-13-17-26(18-14-23)32-29(34)19-27(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-18,20,27H,19H2,(H,32,34) |
| InChIKey | LIBDHKRRPVBHIC-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |