C23H18ClN3OS — CID 122286290
1-(3-chloro-4-methylphenyl)-3-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea (PubChem CID 122286290) has the molecular formula C23H18ClN3OS and a molecular weight of 419.94 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 122286290 |
| Molecular Formula | C23H18ClN3OS |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(-c3csc(-c4ccccc4)n3)cc2)cc1Cl |
| InChI | InChI=1S/C23H18ClN3OS/c1-15-7-10-19(13-20(15)24)26-23(28)25-18-11-8-16(9-12-18)21-14-29-22(27-21)17-5-3-2-4-6-17/h2-14H,1H3,(H2,25,26,28) |
| InChIKey | SORFVIJKUFLKMU-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |