C24H16Cl2N2OS — CID 108751443
(E)-3-(2,4-dichlorophenyl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide (PubChem CID 108751443) has the molecular formula C24H16Cl2N2OS and a molecular weight of 451.38 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108751443 |
| Molecular Formula | C24H16Cl2N2OS |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1ccc(-c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H16Cl2N2OS/c25-19-10-6-16(21(26)14-19)9-13-23(29)27-20-11-7-17(8-12-20)22-15-30-24(28-22)18-4-2-1-3-5-18/h1-15H,(H,27,29)/b13-9+ |
| InChIKey | JWXFJDGBTHAXNA-UKTHLTGXSA-N |
| XLogP | 7.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|