C24H16ClN3O3S — CID 108748130
(E)-N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 108748130) has the molecular formula C24H16ClN3O3S and a molecular weight of 461.93 g/mol. Its IUPAC name is (E)-N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108748130 |
| Molecular Formula | C24H16ClN3O3S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (E)-N-[4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)Nc1ccc(-c2csc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C24H16ClN3O3S/c25-19-8-4-18(5-9-19)24-27-22(15-32-24)17-6-10-20(11-7-17)26-23(29)14-3-16-1-12-21(13-2-16)28(30)31/h1-15H,(H,26,29)/b14-3+ |
| InChIKey | BOOIBCPBDSLRJL-LZWSPWQCSA-N |
| XLogP | 6.69 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|