C18H14ClN3OS — CID 28865321
(E)-N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 28865321) has the molecular formula C18H14ClN3OS and a molecular weight of 355.85 g/mol. Its IUPAC name is (E)-N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 28865321 |
| Molecular Formula | C18H14ClN3OS |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | (E)-N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | Nc1nc(-c2ccc(NC(=O)/C=C/c3ccc(Cl)cc3)cc2)cs1 |
| InChI | InChI=1S/C18H14ClN3OS/c19-14-6-1-12(2-7-14)3-10-17(23)21-15-8-4-13(5-9-15)16-11-24-18(20)22-16/h1-11H,(H2,20,22)(H,21,23)/b10-3+ |
| InChIKey | AQGRHSNHTBORSE-XCVCLJGOSA-N |
| XLogP | 4.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|