C19H13Cl2N3OS2 — CID 4199760
3-(4-chlorophenyl)-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide (PubChem CID 4199760) has the molecular formula C19H13Cl2N3OS2 and a molecular weight of 434.37 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4199760 |
| Molecular Formula | C19H13Cl2N3OS2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)NC(=S)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C19H13Cl2N3OS2/c20-14-6-1-12(2-7-14)3-10-17(25)23-18(26)24-19-22-16(11-27-19)13-4-8-15(21)9-5-13/h1-11H,(H2,22,23,24,25,26) |
| InChIKey | NERCQUWNZAXUDT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|