C18H15N3O2S2 — CID 1299086
3-(furan-2-yl)-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide (PubChem CID 1299086) has the molecular formula C18H15N3O2S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 1299086 |
| Molecular Formula | C18H15N3O2S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 3-(furan-2-yl)-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2csc(NC(=S)NC(=O)C=Cc3ccco3)n2)cc1 |
| InChI | InChI=1S/C18H15N3O2S2/c1-12-4-6-13(7-5-12)15-11-25-18(19-15)21-17(24)20-16(22)9-8-14-3-2-10-23-14/h2-11H,1H3,(H2,19,20,21,22,24) |
| InChIKey | OOGGYCGJQCQIRD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|