C13H12N2O4S — CID 43623022
methyl 2-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 43623022) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is methyl 2-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 43623022 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | methyl 2-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NC(=O)/C=C/c2ccco2)n1 |
| InChI | InChI=1S/C13H12N2O4S/c1-18-12(17)7-9-8-20-13(14-9)15-11(16)5-4-10-3-2-6-19-10/h2-6,8H,7H2,1H3,(H,14,15,16)/b5-4+ |
| InChIKey | AFPJYGATSSFLSW-SNAWJCMRSA-N |
| XLogP | 2.10 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|