C15H17N3O3S — CID 51072840
(E)-3-(furan-2-yl)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 51072840) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 51072840 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1nc(CN2CCOCC2)cs1 |
| InChI | InChI=1S/C15H17N3O3S/c19-14(4-3-13-2-1-7-21-13)17-15-16-12(11-22-15)10-18-5-8-20-9-6-18/h1-4,7,11H,5-6,8-10H2,(H,16,17,19)/b4-3+ |
| InChIKey | YBRHEWYMIKBCTD-ONEGZZNKSA-N |
| XLogP | 2.22 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|