C15H13N3O5S — CID 102534944
methyl 2-[2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 102534944) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is methyl 2-[2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 102534944 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | methyl 2-[2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C15H13N3O5S/c1-23-14(20)8-11-9-24-15(16-11)17-13(19)7-4-10-2-5-12(6-3-10)18(21)22/h2-7,9H,8H2,1H3,(H,16,17,19)/b7-4+ |
| InChIKey | DNVZLYMKXXXGFP-QPJJXVBHSA-N |
| XLogP | 2.42 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|