C13H9N3O5S — CID 28858305
2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 28858305) has the molecular formula C13H9N3O5S and a molecular weight of 319.30 g/mol. Its IUPAC name is 2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 28858305 |
| Molecular Formula | C13H9N3O5S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)Nc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C13H9N3O5S/c17-11(15-13-14-10(7-22-13)12(18)19)6-3-8-1-4-9(5-2-8)16(20)21/h1-7H,(H,18,19)(H,14,15,17)/b6-3+ |
| InChIKey | BDQKOKFILUEWQF-ZZXKWVIFSA-N |
| XLogP | 2.40 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|