C18H11F2N3O3S — CID 16910398
(Z)-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 16910398) has the molecular formula C18H11F2N3O3S and a molecular weight of 387.37 g/mol. Its IUPAC name is (Z)-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16910398 |
| Molecular Formula | C18H11F2N3O3S |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (Z)-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C\c1ccc([N+](=O)[O-])cc1)Nc1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C18H11F2N3O3S/c19-14-7-4-12(9-15(14)20)16-10-27-18(21-16)22-17(24)8-3-11-1-5-13(6-2-11)23(25)26/h1-10H,(H,21,22,24)/b8-3- |
| InChIKey | XBDCYMYDGOGUOS-BAQGIRSFSA-N |
| XLogP | 4.65 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|