C19H12F4N2O2S — CID 8895529
(E)-3-[4-(difluoromethoxy)phenyl]-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 8895529) has the molecular formula C19H12F4N2O2S and a molecular weight of 408.38 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 8895529 |
| Molecular Formula | C19H12F4N2O2S |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)Nc1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C19H12F4N2O2S/c20-14-7-4-12(9-15(14)21)16-10-28-19(24-16)25-17(26)8-3-11-1-5-13(6-2-11)27-18(22)23/h1-10,18H,(H,24,25,26)/b8-3+ |
| InChIKey | DISMOTPVDIKZEB-FPYGCLRLSA-N |
| XLogP | 5.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|