C21H18F2N2O3S — CID 57484961
(E)-3-[4-(2,2-difluoroethoxy)phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 57484961) has the molecular formula C21H18F2N2O3S and a molecular weight of 416.45 g/mol. Its IUPAC name is (E)-3-[4-(2,2-difluoroethoxy)phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2,2-difluoroethoxy)phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 57484961 |
| Molecular Formula | C21H18F2N2O3S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (E)-3-[4-(2,2-difluoroethoxy)phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)/C=C/c3ccc(OCC(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C21H18F2N2O3S/c1-27-16-9-5-15(6-10-16)18-13-29-21(24-18)25-20(26)11-4-14-2-7-17(8-3-14)28-12-19(22)23/h2-11,13,19H,12H2,1H3,(H,24,25,26)/b11-4+ |
| InChIKey | GYYNQXFGFIDYJT-NYYWCZLTSA-N |
| XLogP | 5.11 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|