C24H20N2O2S3 — CID 87722642
(E)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-(thiophen-2-ylmethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 87722642) has the molecular formula C24H20N2O2S3 and a molecular weight of 464.64 g/mol. Its IUPAC name is (E)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-(thiophen-2-ylmethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-(thiophen-2-ylmethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 87722642 |
| Molecular Formula | C24H20N2O2S3 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | (E)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-(thiophen-2-ylmethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)/C=C/c3ccc(SCc4cccs4)cc3)n2)cc1 |
| InChI | InChI=1S/C24H20N2O2S3/c1-28-19-9-7-18(8-10-19)22-16-31-24(25-22)26-23(27)13-6-17-4-11-20(12-5-17)30-15-21-3-2-14-29-21/h2-14,16H,15H2,1H3,(H,25,26,27)/b13-6+ |
| InChIKey | DFGFWFWLQYKYBO-AWNIVKPZSA-N |
| XLogP | 6.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|