C16H14N2O2S2 — CID 8002261
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 8002261) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 8002261 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | COc1ccc(-c2csc(NC(=O)Cc3cccs3)n2)cc1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-20-12-6-4-11(5-7-12)14-10-22-16(17-14)18-15(19)9-13-3-2-8-21-13/h2-8,10H,9H2,1H3,(H,17,18,19) |
| InChIKey | AGMDKIRGPHAMQJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|