C17H14N2O3S2 — CID 30515195
methyl 4-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]benzoate (PubChem CID 30515195) has the molecular formula C17H14N2O3S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl 4-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]benzoate.
| Compound Name | methyl 4-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 30515195 |
| Molecular Formula | C17H14N2O3S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | methyl 4-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2csc(NC(=O)Cc3cccs3)n2)cc1 |
| InChI | InChI=1S/C17H14N2O3S2/c1-22-16(21)12-6-4-11(5-7-12)14-10-24-17(18-14)19-15(20)9-13-3-2-8-23-13/h2-8,10H,9H2,1H3,(H,18,19,20) |
| InChIKey | KWGKDJUYWQOTAZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|