C14H11N3O3S — CID 146190126
methyl 4-[2-[(2-cyanoacetyl)amino]-1,3-thiazol-4-yl]benzoate (PubChem CID 146190126) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is methyl 4-[2-[(2-cyanoacetyl)amino]-1,3-thiazol-4-yl]benzoate.
| Compound Name | methyl 4-[2-[(2-cyanoacetyl)amino]-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 146190126 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | methyl 4-[2-[(2-cyanoacetyl)amino]-1,3-thiazol-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2csc(NC(=O)CC#N)n2)cc1 |
| InChI | InChI=1S/C14H11N3O3S/c1-20-13(19)10-4-2-9(3-5-10)11-8-21-14(16-11)17-12(18)6-7-15/h2-5,8H,6H2,1H3,(H,16,17,18) |
| InChIKey | ICWZOGODOGTHMN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |