C11H10N2O2S — CID 2060012
methyl 4-(2-amino-1,3-thiazol-4-yl)benzoate (PubChem CID 2060012) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is methyl 4-(2-amino-1,3-thiazol-4-yl)benzoate.
| Compound Name | methyl 4-(2-amino-1,3-thiazol-4-yl)benzoate |
|---|---|
| PubChem CID | 2060012 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | methyl 4-(2-amino-1,3-thiazol-4-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2csc(N)n2)cc1 |
| InChI | InChI=1S/C11H10N2O2S/c1-15-10(14)8-4-2-7(3-5-8)9-6-16-11(12)13-9/h2-6H,1H3,(H2,12,13) |
| InChIKey | FKEIGGWJRUYGHR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |