C19H18N2O3S — CID 28856582
ethyl 4-[[4-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzoate (PubChem CID 28856582) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is ethyl 4-[[4-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzoate.
| Compound Name | ethyl 4-[[4-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 28856582 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | ethyl 4-[[4-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(COc2ccc(-c3csc(N)n3)cc2)cc1 |
| InChI | InChI=1S/C19H18N2O3S/c1-2-23-18(22)15-5-3-13(4-6-15)11-24-16-9-7-14(8-10-16)17-12-25-19(20)21-17/h3-10,12H,2,11H2,1H3,(H2,20,21) |
| InChIKey | YUHBDVCYPYFZGG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |