C19H19N3O3S — CID 28856284
2-[4-(2-amino-1,3-thiazol-4-yl)phenoxy]-N-(4-ethoxyphenyl)acetamide (PubChem CID 28856284) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-[4-(2-amino-1,3-thiazol-4-yl)phenoxy]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[4-(2-amino-1,3-thiazol-4-yl)phenoxy]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 28856284 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-[4-(2-amino-1,3-thiazol-4-yl)phenoxy]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)COc2ccc(-c3csc(N)n3)cc2)cc1 |
| InChI | InChI=1S/C19H19N3O3S/c1-2-24-15-9-5-14(6-10-15)21-18(23)11-25-16-7-3-13(4-8-16)17-12-26-19(20)22-17/h3-10,12H,2,11H2,1H3,(H2,20,22)(H,21,23) |
| InChIKey | OWKDCDREDVRKPW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |