C20H21N3O2S — CID 3891823
N-[4-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]phenyl]propanamide (PubChem CID 3891823) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[4-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]phenyl]propanamide.
| Compound Name | N-[4-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 3891823 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[4-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]phenyl]propanamide |
| SMILES | CCOc1ccc(Nc2nc(-c3ccc(NC(=O)CC)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-3-19(24)21-15-7-5-14(6-8-15)18-13-26-20(23-18)22-16-9-11-17(12-10-16)25-4-2/h5-13H,3-4H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | UCGXQSMZSZJUAW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |