C17H17N3OS — CID 13155729
4-(4-aminophenyl)-N-(4-ethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 13155729) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-(4-ethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-aminophenyl)-N-(4-ethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 13155729 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-(4-aminophenyl)-N-(4-ethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(Nc2nc(-c3ccc(N)cc3)cs2)cc1 |
| InChI | InChI=1S/C17H17N3OS/c1-2-21-15-9-7-14(8-10-15)19-17-20-16(11-22-17)12-3-5-13(18)6-4-12/h3-11H,2,18H2,1H3,(H,19,20) |
| InChIKey | WOEGWALYGWVGIJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|