C20H21N3O2S2 — CID 19630895
2-(4-aminophenyl)sulfanyl-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 19630895) has the molecular formula C20H21N3O2S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfanyl-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-(4-aminophenyl)sulfanyl-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 19630895 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-(4-aminophenyl)sulfanyl-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CCOc1ccc(-c2csc(NC(=O)C(C)Sc3ccc(N)cc3)n2)cc1 |
| InChI | InChI=1S/C20H21N3O2S2/c1-3-25-16-8-4-14(5-9-16)18-12-26-20(22-18)23-19(24)13(2)27-17-10-6-15(21)7-11-17/h4-13H,3,21H2,1-2H3,(H,22,23,24) |
| InChIKey | OZZNLZRQCUGCFE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|