C24H23N3O5S2 — CID 18895332
(E)-4-[3-[1-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 18895332) has the molecular formula C24H23N3O5S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is (E)-4-[3-[1-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[1-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18895332 |
| Molecular Formula | C24H23N3O5S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (E)-4-[3-[1-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | CCOc1ccc(-c2csc(NC(=O)C(C)Sc3cccc(NC(=O)/C=C/C(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C24H23N3O5S2/c1-3-32-18-9-7-16(8-10-18)20-14-33-24(26-20)27-23(31)15(2)34-19-6-4-5-17(13-19)25-21(28)11-12-22(29)30/h4-15H,3H2,1-2H3,(H,25,28)(H,29,30)(H,26,27,31)/b12-11+ |
| InChIKey | JLKWWAMYKVOUCM-VAWYXSNFSA-N |
| XLogP | 4.91 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|