C22H19N3O4S2 — CID 18895334
(E)-4-oxo-4-[3-[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl]sulfanylanilino]but-2-enoic acid (PubChem CID 18895334) has the molecular formula C22H19N3O4S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is (E)-4-oxo-4-[3-[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl]sulfanylanilino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[3-[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl]sulfanylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 18895334 |
| Molecular Formula | C22H19N3O4S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (E)-4-oxo-4-[3-[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl]sulfanylanilino]but-2-enoic acid |
| SMILES | CC(Sc1cccc(NC(=O)/C=C/C(=O)O)c1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H19N3O4S2/c1-14(21(29)25-22-24-18(13-30-22)15-6-3-2-4-7-15)31-17-9-5-8-16(12-17)23-19(26)10-11-20(27)28/h2-14H,1H3,(H,23,26)(H,27,28)(H,24,25,29)/b11-10+ |
| InChIKey | CGTNVWAFSWYFKT-ZHACJKMWSA-N |
| XLogP | 4.51 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|