C29H24N4OS3 — CID 19315963
N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide (PubChem CID 19315963) has the molecular formula C29H24N4OS3 and a molecular weight of 540.74 g/mol. Its IUPAC name is N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide.
| Compound Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19315963 |
| Molecular Formula | C29H24N4OS3 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
| SMILES | CC(Sc1cccc(NC(=S)Nc2ccccc2)c1)C(=O)Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C29H24N4OS3/c1-19(37-25-13-7-12-24(17-25)31-28(35)30-23-10-3-2-4-11-23)27(34)33-29-32-26(18-36-29)22-15-14-20-8-5-6-9-21(20)16-22/h2-19H,1H3,(H2,30,31,35)(H,32,33,34) |
| InChIKey | LXCCNPFHILQOMT-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|