C28H26N4O3S3 — CID 19316193
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 19316193) has the molecular formula C28H26N4O3S3 and a molecular weight of 562.74 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 19316193 |
| Molecular Formula | C28H26N4O3S3 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | COc1ccccc1-c1csc(NC(=O)C(C)Sc2cccc(NC(=S)Nc3ccc(C(C)=O)cc3)c2)n1 |
| InChI | InChI=1S/C28H26N4O3S3/c1-17(33)19-11-13-20(14-12-19)29-27(36)30-21-7-6-8-22(15-21)38-18(2)26(34)32-28-31-24(16-37-28)23-9-4-5-10-25(23)35-3/h4-16,18H,1-3H3,(H2,29,30,36)(H,31,32,34) |
| InChIKey | FZKUOXPQXKLAFI-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|