C29H24N4O2S3 — CID 19317883
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-cyano-4-phenylthiophen-2-yl)propanamide (PubChem CID 19317883) has the molecular formula C29H24N4O2S3 and a molecular weight of 556.74 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-cyano-4-phenylthiophen-2-yl)propanamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-cyano-4-phenylthiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 19317883 |
| Molecular Formula | C29H24N4O2S3 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3-cyano-4-phenylthiophen-2-yl)propanamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C)C(=O)Nc3scc(-c4ccccc4)c3C#N)c2)cc1 |
| InChI | InChI=1S/C29H24N4O2S3/c1-18(34)20-11-13-22(14-12-20)31-29(36)32-23-9-6-10-24(15-23)38-19(2)27(35)33-28-25(16-30)26(17-37-28)21-7-4-3-5-8-21/h3-15,17,19H,1-2H3,(H,33,35)(H2,31,32,36) |
| InChIKey | BHSVHDKFXVXUCK-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|