C32H24N4OS3 — CID 19317525
N-(3-cyano-4-phenylthiophen-2-yl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19317525) has the molecular formula C32H24N4OS3 and a molecular weight of 576.77 g/mol. Its IUPAC name is N-(3-cyano-4-phenylthiophen-2-yl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(3-cyano-4-phenylthiophen-2-yl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19317525 |
| Molecular Formula | C32H24N4OS3 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | N-(3-cyano-4-phenylthiophen-2-yl)-2-phenyl-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | N#Cc1c(-c2ccccc2)csc1NC(=O)C(Sc1cccc(NC(=S)Nc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C32H24N4OS3/c33-20-27-28(22-11-4-1-5-12-22)21-39-31(27)36-30(37)29(23-13-6-2-7-14-23)40-26-18-10-17-25(19-26)35-32(38)34-24-15-8-3-9-16-24/h1-19,21,29H,(H,36,37)(H2,34,35,38) |
| InChIKey | DRBLDWNXQLVQJX-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|