C32H22N4O4S2 — CID 18910676
N-[3-[2-[(3-cyano-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 18910676) has the molecular formula C32H22N4O4S2 and a molecular weight of 590.69 g/mol. Its IUPAC name is N-[3-[2-[(3-cyano-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[2-[(3-cyano-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18910676 |
| Molecular Formula | C32H22N4O4S2 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | N-[3-[2-[(3-cyano-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | N#Cc1c(-c2ccccc2)csc1NC(=O)C(Sc1cccc(NC(=O)c2cccc([N+](=O)[O-])c2)c1)c1ccccc1 |
| InChI | InChI=1S/C32H22N4O4S2/c33-19-27-28(21-9-3-1-4-10-21)20-41-32(27)35-31(38)29(22-11-5-2-6-12-22)42-26-16-8-14-24(18-26)34-30(37)23-13-7-15-25(17-23)36(39)40/h1-18,20,29H,(H,34,37)(H,35,38) |
| InChIKey | NMYFHBXNCSARGA-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|