C31H25N5O5S2 — CID 18910677
N-[3-[2-[(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 18910677) has the molecular formula C31H25N5O5S2 and a molecular weight of 611.71 g/mol. Its IUPAC name is N-[3-[2-[(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[2-[(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18910677 |
| Molecular Formula | C31H25N5O5S2 |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.13 |
| IUPAC Name | N-[3-[2-[(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | CC(=O)N1CCc2c(sc(NC(=O)C(Sc3cccc(NC(=O)c4cccc([N+](=O)[O-])c4)c3)c3ccccc3)c2C#N)C1 |
| InChI | InChI=1S/C31H25N5O5S2/c1-19(37)35-14-13-25-26(17-32)31(43-27(25)18-35)34-30(39)28(20-7-3-2-4-8-20)42-24-12-6-10-22(16-24)33-29(38)21-9-5-11-23(15-21)36(40)41/h2-12,15-16,28H,13-14,18H2,1H3,(H,33,38)(H,34,39) |
| InChIKey | JLEVBZJPKFMWFZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|