C27H25N5O5S2 — CID 18910776
N-[3-[1-[(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 18910776) has the molecular formula C27H25N5O5S2 and a molecular weight of 563.66 g/mol. Its IUPAC name is N-[3-[1-[(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[1-[(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 18910776 |
| Molecular Formula | C27H25N5O5S2 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | N-[3-[1-[(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1)C(=O)Nc1sc2c(c1C#N)CCN(C(C)=O)C2 |
| InChI | InChI=1S/C27H25N5O5S2/c1-3-23(26(35)30-27-22(14-28)21-11-12-31(16(2)33)15-24(21)39-27)38-20-6-4-5-18(13-20)29-25(34)17-7-9-19(10-8-17)32(36)37/h4-10,13,23H,3,11-12,15H2,1-2H3,(H,29,34)(H,30,35) |
| InChIKey | LBJCSYILESPMSP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|