C31H28Cl4N4O6S2 — CID 18897781
2,3,4,5-tetrachloro-6-[[3-[1-[[3-cyano-6-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18897781) has the molecular formula C31H28Cl4N4O6S2 and a molecular weight of 758.53 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[1-[[3-cyano-6-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[1-[[3-cyano-6-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18897781 |
| Molecular Formula | C31H28Cl4N4O6S2 |
| Molecular Weight | 758.53 g/mol |
| Exact Mass | 756.02 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[1-[[3-cyano-6-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)C(=O)Nc1sc2c(c1C#N)CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C31H28Cl4N4O6S2/c1-5-18(26(40)38-28-17(12-36)16-9-10-39(13-19(16)47-28)30(44)45-31(2,3)4)46-15-8-6-7-14(11-15)37-27(41)20-21(29(42)43)23(33)25(35)24(34)22(20)32/h6-8,11,18H,5,9-10,13H2,1-4H3,(H,37,41)(H,38,40)(H,42,43) |
| InChIKey | HBKIYORUFOGPDZ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 148.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.53 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|