C28H27N5O6S2 — CID 18910744
tert-butyl 3-cyano-2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 18910744) has the molecular formula C28H27N5O6S2 and a molecular weight of 593.69 g/mol. Its IUPAC name is tert-butyl 3-cyano-2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl 3-cyano-2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 18910744 |
| Molecular Formula | C28H27N5O6S2 |
| Molecular Weight | 593.69 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | tert-butyl 3-cyano-2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(sc(NC(=O)CSc3cccc(NC(=O)c4ccc([N+](=O)[O-])cc4)c3)c2C#N)C1 |
| InChI | InChI=1S/C28H27N5O6S2/c1-28(2,3)39-27(36)32-12-11-21-22(14-29)26(41-23(21)15-32)31-24(34)16-40-20-6-4-5-18(13-20)30-25(35)17-7-9-19(10-8-17)33(37)38/h4-10,13H,11-12,15-16H2,1-3H3,(H,30,35)(H,31,34) |
| InChIKey | DYVNPMRYNKIFKJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.69 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|