C30H25N5O5S2 — CID 18910784
4-cyano-3-methyl-5-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]-N-phenylthiophene-2-carboxamide (PubChem CID 18910784) has the molecular formula C30H25N5O5S2 and a molecular weight of 599.69 g/mol. Its IUPAC name is 4-cyano-3-methyl-5-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]-N-phenylthiophene-2-carboxamide.
| Compound Name | 4-cyano-3-methyl-5-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]-N-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18910784 |
| Molecular Formula | C30H25N5O5S2 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.13 |
| IUPAC Name | 4-cyano-3-methyl-5-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]-N-phenylthiophene-2-carboxamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1)C(=O)Nc1sc(C(=O)Nc2ccccc2)c(C)c1C#N |
| InChI | InChI=1S/C30H25N5O5S2/c1-3-25(41-23-11-7-10-21(16-23)33-27(36)19-12-14-22(15-13-19)35(39)40)28(37)34-30-24(17-31)18(2)26(42-30)29(38)32-20-8-5-4-6-9-20/h4-16,25H,3H2,1-2H3,(H,32,38)(H,33,36)(H,34,37) |
| InChIKey | OCDOUUFCRUPEQE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 154.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|