C23H22N4O6S2 — CID 18905455
4-nitro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18905455) has the molecular formula C23H22N4O6S2 and a molecular weight of 514.59 g/mol. Its IUPAC name is 4-nitro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-nitro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18905455 |
| Molecular Formula | C23H22N4O6S2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 4-nitro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H22N4O6S2/c1-2-21(23(29)25-16-8-12-20(13-9-16)35(24,32)33)34-19-5-3-4-17(14-19)26-22(28)15-6-10-18(11-7-15)27(30)31/h3-14,21H,2H2,1H3,(H,25,29)(H,26,28)(H2,24,32,33) |
| InChIKey | BLCMZYOUWCKFGV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|