C20H25N3O4S2 — CID 18901711
2-[3-(butanoylamino)phenyl]sulfanyl-N-(4-sulfamoylphenyl)butanamide (PubChem CID 18901711) has the molecular formula C20H25N3O4S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[3-(butanoylamino)phenyl]sulfanyl-N-(4-sulfamoylphenyl)butanamide.
| Compound Name | 2-[3-(butanoylamino)phenyl]sulfanyl-N-(4-sulfamoylphenyl)butanamide |
|---|---|
| PubChem CID | 18901711 |
| Molecular Formula | C20H25N3O4S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-[3-(butanoylamino)phenyl]sulfanyl-N-(4-sulfamoylphenyl)butanamide |
| SMILES | CCCC(=O)Nc1cccc(SC(CC)C(=O)Nc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C20H25N3O4S2/c1-3-6-19(24)22-15-7-5-8-16(13-15)28-18(4-2)20(25)23-14-9-11-17(12-10-14)29(21,26)27/h5,7-13,18H,3-4,6H2,1-2H3,(H,22,24)(H,23,25)(H2,21,26,27) |
| InChIKey | SGVAHLMYCIUBEL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |