C23H22FN3O4S2 — CID 18904303
4-fluoro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18904303) has the molecular formula C23H22FN3O4S2 and a molecular weight of 487.58 g/mol. Its IUPAC name is 4-fluoro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18904303 |
| Molecular Formula | C23H22FN3O4S2 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 4-fluoro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc(F)cc2)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H22FN3O4S2/c1-2-21(23(29)26-17-10-12-20(13-11-17)33(25,30)31)32-19-5-3-4-18(14-19)27-22(28)15-6-8-16(24)9-7-15/h3-14,21H,2H2,1H3,(H,26,29)(H,27,28)(H2,25,30,31) |
| InChIKey | YBVRHJQFZVKMFA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |