C23H21Cl2N3O4S2 — CID 18902287
2,4-dichloro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18902287) has the molecular formula C23H21Cl2N3O4S2 and a molecular weight of 538.48 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18902287 |
| Molecular Formula | C23H21Cl2N3O4S2 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 537.04 |
| IUPAC Name | 2,4-dichloro-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H21Cl2N3O4S2/c1-2-21(23(30)27-15-7-9-18(10-8-15)34(26,31)32)33-17-5-3-4-16(13-17)28-22(29)19-11-6-14(24)12-20(19)25/h3-13,21H,2H2,1H3,(H,27,30)(H,28,29)(H2,26,31,32) |
| InChIKey | NVRHKCUNIJZXGR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |