C31H28Cl2N2O4S2 — CID 18909320
ethyl 2-[2-[3-[(2,4-dichlorobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 18909320) has the molecular formula C31H28Cl2N2O4S2 and a molecular weight of 627.62 g/mol. Its IUPAC name is ethyl 2-[2-[3-[(2,4-dichlorobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[(2,4-dichlorobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18909320 |
| Molecular Formula | C31H28Cl2N2O4S2 |
| Molecular Weight | 627.62 g/mol |
| Exact Mass | 626.09 |
| IUPAC Name | ethyl 2-[2-[3-[(2,4-dichlorobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(CC)Sc1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C31H28Cl2N2O4S2/c1-4-26(41-22-8-6-7-21(16-22)34-28(36)23-14-13-20(32)15-25(23)33)29(37)35-30-27(31(38)39-5-2)24(17-40-30)19-11-9-18(3)10-12-19/h6-17,26H,4-5H2,1-3H3,(H,34,36)(H,35,37) |
| InChIKey | QPGSEEYDLZIRDU-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.62 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|