C31H29N3O6S2 — CID 18910640
ethyl 4-(4-methylphenyl)-2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]thiophene-3-carboxylate (PubChem CID 18910640) has the molecular formula C31H29N3O6S2 and a molecular weight of 603.72 g/mol. Its IUPAC name is ethyl 4-(4-methylphenyl)-2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-methylphenyl)-2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910640 |
| Molecular Formula | C31H29N3O6S2 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | ethyl 4-(4-methylphenyl)-2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylbutanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(CC)Sc1cccc(NC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C31H29N3O6S2/c1-4-26(42-24-11-7-9-22(17-24)32-28(35)21-8-6-10-23(16-21)34(38)39)29(36)33-30-27(31(37)40-5-2)25(18-41-30)20-14-12-19(3)13-15-20/h6-18,26H,4-5H2,1-3H3,(H,32,35)(H,33,36) |
| InChIKey | JOCIJOOYULXDSD-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|