C42H38N4O5S2 — CID 19054868
ethyl 2-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19054868) has the molecular formula C42H38N4O5S2 and a molecular weight of 742.92 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19054868 |
| Molecular Formula | C42H38N4O5S2 |
| Molecular Weight | 742.92 g/mol |
| Exact Mass | 742.23 |
| IUPAC Name | ethyl 2-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(CC)Sc1cccc(NC(=O)/C(=C/c2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C42H38N4O5S2/c1-4-36(40(49)46-41-37(42(50)51-5-2)33(25-52-41)27-20-18-26(3)19-21-27)53-31-15-11-14-30(23-31)44-39(48)35(45-38(47)28-12-7-6-8-13-28)22-29-24-43-34-17-10-9-16-32(29)34/h6-25,36,43H,4-5H2,1-3H3,(H,44,48)(H,45,47)(H,46,49)/b35-22- |
| InChIKey | ONFWZTHBGLVFAH-QHDYCIAZSA-N |
| XLogP | 9.30 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.92 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|