C41H39N3O7S2 — CID 19051303
methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19051303) has the molecular formula C41H39N3O7S2 and a molecular weight of 749.91 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051303 |
| Molecular Formula | C41H39N3O7S2 |
| Molecular Weight | 749.91 g/mol |
| Exact Mass | 749.22 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)ccc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1scc(-c2ccc(C)cc2)c1C(=O)OC |
| InChI | InChI=1S/C41H39N3O7S2/c1-6-35(39(47)44-40-36(41(48)51-5)32(24-52-40)26-17-15-25(2)16-18-26)53-31-14-10-13-29(23-31)42-38(46)33(43-37(45)27-11-8-7-9-12-27)22-28-21-30(49-3)19-20-34(28)50-4/h7-24,35H,6H2,1-5H3,(H,42,46)(H,43,45)(H,44,47)/b33-22+ |
| InChIKey | YAVWMZJQZSZMSK-STKMKYKTSA-N |
| XLogP | 8.45 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.91 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|