C39H34N4O7S2 — CID 19322427
methyl 2-[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19322427) has the molecular formula C39H34N4O7S2 and a molecular weight of 734.86 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19322427 |
| Molecular Formula | C39H34N4O7S2 |
| Molecular Weight | 734.86 g/mol |
| Exact Mass | 734.19 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)c1)C(=O)Nc1scc(-c2ccc(C)cc2)c1C(=O)OC |
| InChI | InChI=1S/C39H34N4O7S2/c1-4-33(37(46)42-38-34(39(47)50-3)30(23-51-38)25-19-17-24(2)18-20-25)52-29-15-10-14-28(22-29)40-36(45)31(41-35(44)26-11-6-5-7-12-26)21-27-13-8-9-16-32(27)43(48)49/h5-23,33H,4H2,1-3H3,(H,40,45)(H,41,44)(H,42,46)/b31-21+ |
| InChIKey | ORGMBHGBTCAJSU-NJZRLIGZSA-N |
| XLogP | 8.34 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.86 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|